C12H11ClN4 — CID 102669740
4-[[4-(aminomethyl)pyrazol-1-yl]methyl]-3-chlorobenzonitrile (PubChem CID 102669740) has the molecular formula C12H11ClN4 and a molecular weight of 246.70 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)pyrazol-1-yl]methyl]-3-chlorobenzonitrile.
| Compound Name | 4-[[4-(aminomethyl)pyrazol-1-yl]methyl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 102669740 |
| Molecular Formula | C12H11ClN4 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-[[4-(aminomethyl)pyrazol-1-yl]methyl]-3-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cn2cc(CN)cn2)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClN4/c13-12-3-9(4-14)1-2-11(12)8-17-7-10(5-15)6-16-17/h1-3,6-7H,5,8,15H2 |
| InChIKey | LVEKTIDCVRTVFY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |