About 2-triphenylsilylethanol
2-triphenylsilylethanol (PubChem CID 10267053) has the molecular formula C20H20OSi
and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-triphenylsilylethanol.
Molecular Properties
| Compound Name | 2-triphenylsilylethanol |
| PubChem CID | 10267053 |
| Molecular Formula | C20H20OSi |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-triphenylsilylethanol |
| SMILES | OCC[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20OSi/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17H2 |
| InChIKey | ZMNVUTIPHLYJEW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-triphenylsilylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-triphenylsilylethanol?
The IUPAC name of 2-triphenylsilylethanol (CID 10267053) is 2-triphenylsilylethanol.
What is the SMILES notation for 2-triphenylsilylethanol?
The canonical SMILES for 2-triphenylsilylethanol is OCC[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-triphenylsilylethanol?
The InChIKey is ZMNVUTIPHLYJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20OSi/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17H2.
What are the key properties of 2-triphenylsilylethanol?
2-triphenylsilylethanol has a molecular weight of 304.47 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-triphenylsilylethanol is sourced from PubChem (CID 10267053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).