C20H32O2 — CID 10267055
(4E,8S,9S,11R,14S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yltricyclo[7.5.0.010,14]tetradec-4-en-2-one (PubChem CID 10267055) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (4E,8S,9S,11R,14S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yltricyclo[7.5.0.010,14]tetradec-4-en-2-one.
| Compound Name | (4E,8S,9S,11R,14S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yltricyclo[7.5.0.010,14]tetradec-4-en-2-one |
|---|---|
| PubChem CID | 10267055 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4E,8S,9S,11R,14S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yltricyclo[7.5.0.010,14]tetradec-4-en-2-one |
| SMILES | C/C1=C\CC[C@](C)(O)[C@@H]2C(C(=O)C1)[C@@]1(C)CCC(C(C)C)C21 |
| InChI | InChI=1S/C20H32O2/c1-12(2)14-8-10-19(4)16(14)18-17(19)15(21)11-13(3)7-6-9-20(18,5)22/h7,12,14,16-18,22H,6,8-11H2,1-5H3/b13-7+/t14?,16?,17?,18-,19-,20-/m0/s1 |
| InChIKey | GDSHUCXXDXYKPM-YEAHULPPSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|