About N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine (PubChem CID 102671202) has the molecular formula C13H15FN4S
and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine.
Molecular Properties
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine |
| PubChem CID | 102671202 |
| Molecular Formula | C13H15FN4S |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine |
| SMILES | CC1SCCC1Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C13H15FN4S/c1-9-12(4-5-19-9)17-10-2-3-13(11(14)6-10)18-8-15-7-16-18/h2-3,6-9,12,17H,4-5H2,1H3 |
| InChIKey | BDCPOLFXSCYMHQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine?
The IUPAC name of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine (CID 102671202) is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine.
What is the SMILES notation for N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine?
The canonical SMILES for N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine is CC1SCCC1Nc1ccc(-n2cncn2)c(F)c1.
What is the InChIKey of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine?
The InChIKey is BDCPOLFXSCYMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN4S/c1-9-12(4-5-19-9)17-10-2-3-13(11(14)6-10)18-8-15-7-16-18/h2-3,6-9,12,17H,4-5H2,1H3.
What are the key properties of N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine?
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine has a molecular weight of 278.36 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-2-methylthiolan-3-amine is sourced from PubChem (CID 102671202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).