C12H15ClFNS — CID 102671917
N-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-amine (PubChem CID 102671917) has the molecular formula C12H15ClFNS and a molecular weight of 259.78 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-amine |
|---|---|
| PubChem CID | 102671917 |
| Molecular Formula | C12H15ClFNS |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-amine |
| SMILES | CC1SCCC1NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNS/c1-8-12(4-5-16-8)15-7-9-2-3-11(14)10(13)6-9/h2-3,6,8,12,15H,4-5,7H2,1H3 |
| InChIKey | RAMLWVDMHJYQMU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |