About 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol
3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol (PubChem CID 102672469) has the molecular formula C7H15F2NOS
and a molecular weight of 199.27 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol |
| PubChem CID | 102672469 |
| Molecular Formula | C7H15F2NOS |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol |
| SMILES | CCSCCNCC(O)C(F)F |
| InChI | InChI=1S/C7H15F2NOS/c1-2-12-4-3-10-5-6(11)7(8)9/h6-7,10-11H,2-5H2,1H3 |
| InChIKey | TWBNNPVGVJTRGU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol?
The IUPAC name of 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol (CID 102672469) is 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol is CCSCCNCC(O)C(F)F.
What is the InChIKey of 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol?
The InChIKey is TWBNNPVGVJTRGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2NOS/c1-2-12-4-3-10-5-6(11)7(8)9/h6-7,10-11H,2-5H2,1H3.
What are the key properties of 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol?
3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol has a molecular weight of 199.27 g/mol, XLogP of 0.96, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylsulfanylethylamino)-1,1-difluoropropan-2-ol is sourced from PubChem (CID 102672469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).