C17H29NO — CID 102673404
4-[3-(2,2,3-trimethylbutylamino)butyl]phenol (PubChem CID 102673404) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 4-[3-(2,2,3-trimethylbutylamino)butyl]phenol.
| Compound Name | 4-[3-(2,2,3-trimethylbutylamino)butyl]phenol |
|---|---|
| PubChem CID | 102673404 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-[3-(2,2,3-trimethylbutylamino)butyl]phenol |
| SMILES | CC(CCc1ccc(O)cc1)NCC(C)(C)C(C)C |
| InChI | InChI=1S/C17H29NO/c1-13(2)17(4,5)12-18-14(3)6-7-15-8-10-16(19)11-9-15/h8-11,13-14,18-19H,6-7,12H2,1-5H3 |
| InChIKey | MIPOEJXNSNPUOQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |