About S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate
S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate (PubChem CID 10267346) has the molecular formula C18H15NO2S
and a molecular weight of 309.39 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate |
| PubChem CID | 10267346 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate |
| SMILES | Cc1ccc(SC(=O)COc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C18H15NO2S/c1-13-7-9-15(10-8-13)22-17(20)12-21-16-6-2-4-14-5-3-11-19-18(14)16/h2-11H,12H2,1H3 |
| InChIKey | GNMBGTSYRHMXJT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate?
The IUPAC name of S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate (CID 10267346) is S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate.
What is the SMILES notation for S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate?
The canonical SMILES for S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate is Cc1ccc(SC(=O)COc2cccc3cccnc23)cc1.
What is the InChIKey of S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate?
The InChIKey is GNMBGTSYRHMXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2S/c1-13-7-9-15(10-8-13)22-17(20)12-21-16-6-2-4-14-5-3-11-19-18(14)16/h2-11H,12H2,1H3.
What are the key properties of S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate?
S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate has a molecular weight of 309.39 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) 2-quinolin-8-yloxyethanethioate is sourced from PubChem (CID 10267346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).