C12H12BrN3O2 — CID 10267377
6-bromo-9-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione (PubChem CID 10267377) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is 6-bromo-9-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione.
| Compound Name | 6-bromo-9-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10267377 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 6-bromo-9-methyl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
| SMILES | CN1CCc2c(Br)cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C12H12BrN3O2/c1-16-3-2-6-7(5-16)10-9(4-8(6)13)14-11(17)12(18)15-10/h4H,2-3,5H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | OXFLLGUAOMHXPN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|