C11H22N2O2 — CID 102674016
3-methoxy-4-methyl-N-propylpiperidine-1-carboxamide (PubChem CID 102674016) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-methoxy-4-methyl-N-propylpiperidine-1-carboxamide.
| Compound Name | 3-methoxy-4-methyl-N-propylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 102674016 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3-methoxy-4-methyl-N-propylpiperidine-1-carboxamide |
| SMILES | CCCNC(=O)N1CCC(C)C(OC)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-4-6-12-11(14)13-7-5-9(2)10(8-13)15-3/h9-10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | QYQFXJMLETXAQD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |