C10H5BrCl2N2OS — CID 102674220
N-(4-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 102674220) has the molecular formula C10H5BrCl2N2OS and a molecular weight of 352.04 g/mol. Its IUPAC name is N-(4-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(4-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 102674220 |
| Molecular Formula | C10H5BrCl2N2OS |
| Molecular Weight | 352.04 g/mol |
| Exact Mass | 349.87 |
| IUPAC Name | N-(4-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccn1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H5BrCl2N2OS/c11-5-1-2-14-8(3-5)15-10(16)6-4-7(12)17-9(6)13/h1-4H,(H,14,15,16) |
| InChIKey | VTVFZRGGHSTJRE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.04 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |