C14H8ClF2NO — CID 102674498
2-chloro-4-[(3,4-difluorophenyl)methoxy]benzonitrile (PubChem CID 102674498) has the molecular formula C14H8ClF2NO and a molecular weight of 279.67 g/mol. Its IUPAC name is 2-chloro-4-[(3,4-difluorophenyl)methoxy]benzonitrile.
| Compound Name | 2-chloro-4-[(3,4-difluorophenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 102674498 |
| Molecular Formula | C14H8ClF2NO |
| Molecular Weight | 279.67 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-chloro-4-[(3,4-difluorophenyl)methoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCc2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C14H8ClF2NO/c15-12-6-11(3-2-10(12)7-18)19-8-9-1-4-13(16)14(17)5-9/h1-6H,8H2 |
| InChIKey | ZXQZPZCDLQVVAN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |