C10H19F3N2O2S — CID 102674826
N-methyl-2-[[3-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide (PubChem CID 102674826) has the molecular formula C10H19F3N2O2S and a molecular weight of 288.34 g/mol. Its IUPAC name is N-methyl-2-[[3-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide.
| Compound Name | N-methyl-2-[[3-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 102674826 |
| Molecular Formula | C10H19F3N2O2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-methyl-2-[[3-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H19F3N2O2S/c1-14-18(16,17)6-5-15-9-4-2-3-8(7-9)10(11,12)13/h8-9,14-15H,2-7H2,1H3 |
| InChIKey | ASKCHTZFVUQODZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |