About 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine
1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine (PubChem CID 10267486) has the molecular formula C12H23ClNO4P
and a molecular weight of 311.75 g/mol. Its IUPAC name is 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine.
Molecular Properties
| Compound Name | 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine |
| PubChem CID | 10267486 |
| Molecular Formula | C12H23ClNO4P |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine |
| SMILES | CC1(C)OCC(CCOP(=O)(Cl)N2CCCCC2)O1 |
| InChI | InChI=1S/C12H23ClNO4P/c1-12(2)16-10-11(18-12)6-9-17-19(13,15)14-7-4-3-5-8-14/h11H,3-10H2,1-2H3 |
| InChIKey | APEFRFAZCOHJEW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine?
The IUPAC name of 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine (CID 10267486) is 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine.
What is the SMILES notation for 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine?
The canonical SMILES for 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine is CC1(C)OCC(CCOP(=O)(Cl)N2CCCCC2)O1.
What is the InChIKey of 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine?
The InChIKey is APEFRFAZCOHJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23ClNO4P/c1-12(2)16-10-11(18-12)6-9-17-19(13,15)14-7-4-3-5-8-14/h11H,3-10H2,1-2H3.
What are the key properties of 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine?
1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine has a molecular weight of 311.75 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[chloro-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phosphoryl]piperidine is sourced from PubChem (CID 10267486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).