C11H20O10 — CID 10267499
(2R,3R,4R)-2,3,4,5-tetrahydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanal (PubChem CID 10267499) has the molecular formula C11H20O10 and a molecular weight of 312.27 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanal.
| Compound Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanal |
|---|---|
| PubChem CID | 10267499 |
| Molecular Formula | C11H20O10 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@](O)(CO)C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O10/c12-1-4(15)9(19)11(20,3-14)10-8(18)7(17)6(16)5(2-13)21-10/h1,4-10,13-20H,2-3H2/t4-,5+,6-,7-,8+,9+,10?,11+/m0/s1 |
| InChIKey | BSRRIWAAIBZEBQ-QSTBWJLLSA-N |
| XLogP | -5.53 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|