C16H28O4Si — CID 10267547
(2R,3S,6R)-6-(1-ethoxyethoxy)-2-(4-trimethylsilylbut-3-ynyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 10267547) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (2R,3S,6R)-6-(1-ethoxyethoxy)-2-(4-trimethylsilylbut-3-ynyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6R)-6-(1-ethoxyethoxy)-2-(4-trimethylsilylbut-3-ynyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 10267547 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2R,3S,6R)-6-(1-ethoxyethoxy)-2-(4-trimethylsilylbut-3-ynyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCOC(C)O[C@@H]1C=C[C@H](O)[C@@H](CCC#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C16H28O4Si/c1-6-18-13(2)19-16-11-10-14(17)15(20-16)9-7-8-12-21(3,4)5/h10-11,13-17H,6-7,9H2,1-5H3/t13?,14-,15+,16-/m0/s1 |
| InChIKey | HVBPKZJKKZIKTQ-UYTSQGDYSA-N |
| XLogP | 2.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|