C18H36O2Si — CID 10267552
(2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-ol (PubChem CID 10267552) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-ol.
| Compound Name | (2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-ol |
|---|---|
| PubChem CID | 10267552 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-ol |
| SMILES | C/C=C(\C)[C@@H](O)CC/C=C/O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-9-17(8)18(19)12-10-11-13-20-21(14(2)3,15(4)5)16(6)7/h9,11,13-16,18-19H,10,12H2,1-8H3/b13-11+,17-9+/t18-/m0/s1 |
| InChIKey | DTWVUVWMCZWZDH-YPDSLFCDSA-N |
| XLogP | 5.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|