C19H27N3O — CID 10267605
8-(3-methyl-1,2,4-oxadiazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10267605) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 8-(3-methyl-1,2,4-oxadiazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-(3-methyl-1,2,4-oxadiazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10267605 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 8-(3-methyl-1,2,4-oxadiazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2cccc(-c3nc(C)no3)c2C1 |
| InChI | InChI=1S/C19H27N3O/c1-4-11-22(12-5-2)16-10-9-15-7-6-8-17(18(15)13-16)19-20-14(3)21-23-19/h6-8,16H,4-5,9-13H2,1-3H3 |
| InChIKey | UESYDGALMZWDRF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |