C13H13ClN2O2 — CID 102676300
N-(2-chloro-4-cyanophenyl)-5-methyloxolane-3-carboxamide (PubChem CID 102676300) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is N-(2-chloro-4-cyanophenyl)-5-methyloxolane-3-carboxamide.
| Compound Name | N-(2-chloro-4-cyanophenyl)-5-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 102676300 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(2-chloro-4-cyanophenyl)-5-methyloxolane-3-carboxamide |
| SMILES | CC1CC(C(=O)Nc2ccc(C#N)cc2Cl)CO1 |
| InChI | InChI=1S/C13H13ClN2O2/c1-8-4-10(7-18-8)13(17)16-12-3-2-9(6-15)5-11(12)14/h2-3,5,8,10H,4,7H2,1H3,(H,16,17) |
| InChIKey | ZJFCWLMYHOPCII-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |