C11H5Cl2F3O3 — CID 10267703
6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 10267703) has the molecular formula C11H5Cl2F3O3 and a molecular weight of 313.06 g/mol. Its IUPAC name is 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 10267703 |
| Molecular Formula | C11H5Cl2F3O3 |
| Molecular Weight | 313.06 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)cc(Cl)c2OC1C(F)(F)F |
| InChI | InChI=1S/C11H5Cl2F3O3/c12-5-1-4-2-6(10(17)18)9(11(14,15)16)19-8(4)7(13)3-5/h1-3,9H,(H,17,18) |
| InChIKey | ZFKBWSREWJOSSJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.06 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |