About N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide
N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide (PubChem CID 102677242) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide |
| PubChem CID | 102677242 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide |
| SMILES | CC1CC(C(=O)NCC(O)CC(C)(C)C)CO1 |
| InChI | InChI=1S/C13H25NO3/c1-9-5-10(8-17-9)12(16)14-7-11(15)6-13(2,3)4/h9-11,15H,5-8H2,1-4H3,(H,14,16) |
| InChIKey | BHOFNMYWVAWAAQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide?
The IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide (CID 102677242) is N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide.
What is the SMILES notation for N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide?
The canonical SMILES for N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide is CC1CC(C(=O)NCC(O)CC(C)(C)C)CO1.
What is the InChIKey of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide?
The InChIKey is BHOFNMYWVAWAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-9-5-10(8-17-9)12(16)14-7-11(15)6-13(2,3)4/h9-11,15H,5-8H2,1-4H3,(H,14,16).
What are the key properties of N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide?
N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide has a molecular weight of 243.35 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-4,4-dimethylpentyl)-5-methyloxolane-3-carboxamide is sourced from PubChem (CID 102677242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).