C17H19N3OS — CID 10267729
5-Pyridin-2-yl-thiophene-2-carboxylic acid (1-aza-bicyclo[2.2.2]oct-3-yl)-amide (PubChem CID 10267729) has the molecular formula C17H19N3OS and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-5-pyridin-2-ylthiophene-2-carboxamide.
| Compound Name | 5-Pyridin-2-yl-thiophene-2-carboxylic acid (1-aza-bicyclo[2.2.2]oct-3-yl)-amide |
|---|---|
| PubChem CID | 10267729 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | C1CN2CCC1C(C2)NC(=O)C3=CC=C(S3)C4=CC=CC=N4 |
| InChI | InChI=1S/C17H19N3OS/c21-17(19-14-11-20-9-6-12(14)7-10-20)16-5-4-15(22-16)13-3-1-2-8-18-13/h1-5,8,12,14H,6-7,9-11H2,(H,19,21) |
| InChIKey | UUSSDOJBSVGPEU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 411 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |