C16H24N2O2 — CID 102677867
4-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-2-ethoxyphenol (PubChem CID 102677867) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-2-ethoxyphenol.
| Compound Name | 4-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-2-ethoxyphenol |
|---|---|
| PubChem CID | 102677867 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-ylmethyl)-2-ethoxyphenol |
| SMILES | CCOc1cc(CN2CCCC3CNCC32)ccc1O |
| InChI | InChI=1S/C16H24N2O2/c1-2-20-16-8-12(5-6-15(16)19)11-18-7-3-4-13-9-17-10-14(13)18/h5-6,8,13-14,17,19H,2-4,7,9-11H2,1H3 |
| InChIKey | BZVNYDOEKOOIFU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |