C15H23BrO2 — CID 10267790
(2E,6E,10E)-11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoic acid (PubChem CID 10267790) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is (2E,6E,10E)-11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoic acid.
| Compound Name | (2E,6E,10E)-11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoic acid |
|---|---|
| PubChem CID | 10267790 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2E,6E,10E)-11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoic acid |
| SMILES | C/C(Br)=C\CC/C(C)=C/CC(C)(C)/C=C/C(=O)O |
| InChI | InChI=1S/C15H23BrO2/c1-12(6-5-7-13(2)16)8-10-15(3,4)11-9-14(17)18/h7-9,11H,5-6,10H2,1-4H3,(H,17,18)/b11-9+,12-8+,13-7+ |
| InChIKey | QKEGEQNDBABUIT-SKTNYSRSSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|