C15H20Cl2N2 — CID 102678131
1-[1-(3,4-dichlorophenyl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102678131) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102678131 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CC(c1ccc(Cl)c(Cl)c1)N1CCCC2CNCC21 |
| InChI | InChI=1S/C15H20Cl2N2/c1-10(11-4-5-13(16)14(17)7-11)19-6-2-3-12-8-18-9-15(12)19/h4-5,7,10,12,15,18H,2-3,6,8-9H2,1H3 |
| InChIKey | UZFNTKKWIZINNW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |