C15H28N2 — CID 102678939
(4aS,7aS)-6-(2,2-dimethylcyclohexyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102678939) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (4aS,7aS)-6-(2,2-dimethylcyclohexyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(2,2-dimethylcyclohexyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102678939 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (4aS,7aS)-6-(2,2-dimethylcyclohexyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CC1(C)CCCCC1N1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C15H28N2/c1-15(2)8-4-3-7-14(15)17-10-12-6-5-9-16-13(12)11-17/h12-14,16H,3-11H2,1-2H3/t12-,13+,14?/m0/s1 |
| InChIKey | GFLWHZHHRZISPU-WLDKUNSKSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |