C16H17FN2OS — CID 102679182
2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(6-fluoro-1-benzothiophen-2-yl)methanone (PubChem CID 102679182) has the molecular formula C16H17FN2OS and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(6-fluoro-1-benzothiophen-2-yl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(6-fluoro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 102679182 |
| Molecular Formula | C16H17FN2OS |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(6-fluoro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1cc2ccc(F)cc2s1)N1CCCC2CNCC21 |
| InChI | InChI=1S/C16H17FN2OS/c17-12-4-3-10-6-15(21-14(10)7-12)16(20)19-5-1-2-11-8-18-9-13(11)19/h3-4,6-7,11,13,18H,1-2,5,8-9H2 |
| InChIKey | WTAVPZPYSXOKLG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |