C14H16BrClN2O — CID 102679300
2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(5-bromo-2-chlorophenyl)methanone (PubChem CID 102679300) has the molecular formula C14H16BrClN2O and a molecular weight of 343.65 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(5-bromo-2-chlorophenyl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(5-bromo-2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 102679300 |
| Molecular Formula | C14H16BrClN2O |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl-(5-bromo-2-chlorophenyl)methanone |
| SMILES | O=C(c1cc(Br)ccc1Cl)N1CCCC2CNCC21 |
| InChI | InChI=1S/C14H16BrClN2O/c15-10-3-4-12(16)11(6-10)14(19)18-5-1-2-9-7-17-8-13(9)18/h3-4,6,9,13,17H,1-2,5,7-8H2 |
| InChIKey | NJVJGOINIMFWQV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |