C13H19NO2 — CID 102679360
3-[[cyclobutyl(2-hydroxyethyl)amino]methyl]phenol (PubChem CID 102679360) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[[cyclobutyl(2-hydroxyethyl)amino]methyl]phenol.
| Compound Name | 3-[[cyclobutyl(2-hydroxyethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 102679360 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-[[cyclobutyl(2-hydroxyethyl)amino]methyl]phenol |
| SMILES | OCCN(Cc1cccc(O)c1)C1CCC1 |
| InChI | InChI=1S/C13H19NO2/c15-8-7-14(12-4-2-5-12)10-11-3-1-6-13(16)9-11/h1,3,6,9,12,15-16H,2,4-5,7-8,10H2 |
| InChIKey | YQOXJFRLZZOBMI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |