furan-3-carboxylic acid

C5H4O3 — CID 10268

IUPACfuran-3-carboxylic acid
SMILESO=C(O)c1ccoc1
InChIInChI=1S/C5H4O3/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7)
InChIKeyIHCCAYCGZOLTEU-UHFFFAOYSA-N
MW112.08 g/mol
LogP0.98
Rot. Bonds1

About furan-3-carboxylic acid

furan-3-carboxylic acid (PubChem CID 10268) has the molecular formula C5H4O3 and a molecular weight of 112.08 g/mol. Its IUPAC name is furan-3-carboxylic acid.

Molecular Properties

Compound Namefuran-3-carboxylic acid
PubChem CID10268
Molecular FormulaC5H4O3
Molecular Weight112.08 g/mol
Exact Mass112.02
IUPAC Namefuran-3-carboxylic acid
SMILESO=C(O)c1ccoc1
InChIInChI=1S/C5H4O3/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7)
InChIKeyIHCCAYCGZOLTEU-UHFFFAOYSA-N
XLogP0.98
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500112.08
LogP ≤ 50.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze furan-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of furan-3-carboxylic acid?
The IUPAC name of furan-3-carboxylic acid (CID 10268) is furan-3-carboxylic acid.
What is the SMILES notation for furan-3-carboxylic acid?
The canonical SMILES for furan-3-carboxylic acid is O=C(O)c1ccoc1.
What is the InChIKey of furan-3-carboxylic acid?
The InChIKey is IHCCAYCGZOLTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7).
What are the key properties of furan-3-carboxylic acid?
furan-3-carboxylic acid has a molecular weight of 112.08 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-carboxylic acid is sourced from PubChem (CID 10268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).