C10H19N3O4S — CID 102680964
ethyl N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfonyl)carbamate (PubChem CID 102680964) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfonyl)carbamate.
| Compound Name | ethyl N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfonyl)carbamate |
|---|---|
| PubChem CID | 102680964 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfonyl)carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C10H19N3O4S/c1-2-17-10(14)12-18(15,16)13-6-8-4-3-5-11-9(8)7-13/h8-9,11H,2-7H2,1H3,(H,12,14) |
| InChIKey | JZVNBTVBKWXUJI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |