About ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate
ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate (PubChem CID 10268130) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate.
Molecular Properties
| Compound Name | ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate |
| PubChem CID | 10268130 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate |
| SMILES | CCO/C(N)=N\c1ccc(CC)c(C2(N)Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-3-14-9-10-17(23-19(21)24-4-2)11-18(14)20(22)12-15-7-5-6-8-16(15)13-20/h5-11H,3-4,12-13,22H2,1-2H3,(H2,21,23) |
| InChIKey | ABFFIVLLSHERLA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate?
The IUPAC name of ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate (CID 10268130) is ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate.
What is the SMILES notation for ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate?
The canonical SMILES for ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate is CCO/C(N)=N\c1ccc(CC)c(C2(N)Cc3ccccc3C2)c1.
What is the InChIKey of ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate?
The InChIKey is ABFFIVLLSHERLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-3-14-9-10-17(23-19(21)24-4-2)11-18(14)20(22)12-15-7-5-6-8-16(15)13-20/h5-11H,3-4,12-13,22H2,1-2H3,(H2,21,23).
What are the key properties of ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate?
ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate has a molecular weight of 323.44 g/mol, XLogP of 3.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N'-[3-(2-amino-1,3-dihydroinden-2-yl)-4-ethylphenyl]carbamimidate is sourced from PubChem (CID 10268130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).