C14H15F5N2 — CID 102681551
1-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102681551) has the molecular formula C14H15F5N2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102681551 |
| Molecular Formula | C14H15F5N2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Fc1c(F)c(F)c(CN2CCCC3CNCC32)c(F)c1F |
| InChI | InChI=1S/C14H15F5N2/c15-10-8(11(16)13(18)14(19)12(10)17)6-21-3-1-2-7-4-20-5-9(7)21/h7,9,20H,1-6H2 |
| InChIKey | DDFCMDWXWFHGIX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|