C11H18N2O2 — CID 102681689
3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)oxolan-2-one (PubChem CID 102681689) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)oxolan-2-one.
| Compound Name | 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)oxolan-2-one |
|---|---|
| PubChem CID | 102681689 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)oxolan-2-one |
| SMILES | O=C1OCCC1N1CCCC2CNCC21 |
| InChI | InChI=1S/C11H18N2O2/c14-11-9(3-5-15-11)13-4-1-2-8-6-12-7-10(8)13/h8-10,12H,1-7H2 |
| InChIKey | XYWOBBWSZLPWBV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |