C14H23ClN4 — CID 102681848
1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102681848) has the molecular formula C14H23ClN4 and a molecular weight of 282.82 g/mol. Its IUPAC name is 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102681848 |
| Molecular Formula | C14H23ClN4 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CCc1nn(C)c(CN2CCCC3CNCC32)c1Cl |
| InChI | InChI=1S/C14H23ClN4/c1-3-11-14(15)13(18(2)17-11)9-19-6-4-5-10-7-16-8-12(10)19/h10,12,16H,3-9H2,1-2H3 |
| InChIKey | BSYSBCXSFFXJCR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |