C14H25N3O3 — CID 102682053
methyl 4-[[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]butanoate (PubChem CID 102682053) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 4-[[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 102682053 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | methyl 4-[[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1CC2CCCNC2C1 |
| InChI | InChI=1S/C14H25N3O3/c1-20-14(19)5-3-7-16-13(18)10-17-8-11-4-2-6-15-12(11)9-17/h11-12,15H,2-10H2,1H3,(H,16,18) |
| InChIKey | DTEGAMZKBZQKSW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|