C13H23N3O — CID 102682962
3-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]azepan-2-one (PubChem CID 102682962) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]azepan-2-one.
| Compound Name | 3-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]azepan-2-one |
|---|---|
| PubChem CID | 102682962 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]azepan-2-one |
| SMILES | O=C1NCCCCC1N1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C13H23N3O/c17-13-12(5-1-2-6-15-13)16-8-10-4-3-7-14-11(10)9-16/h10-12,14H,1-9H2,(H,15,17)/t10-,11+,12?/m0/s1 |
| InChIKey | IRQKFFYLIKATJR-WIKAKEFZSA-N |
| XLogP | 0.34 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |