C12H22N2 — CID 102683076
(4aS,7aS)-6-(2-methylidenebutyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102683076) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (4aS,7aS)-6-(2-methylidenebutyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(2-methylidenebutyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102683076 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (4aS,7aS)-6-(2-methylidenebutyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | C=C(CC)CN1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C12H22N2/c1-3-10(2)7-14-8-11-5-4-6-13-12(11)9-14/h11-13H,2-9H2,1H3/t11-,12+/m0/s1 |
| InChIKey | AWNXASHLCDWNHL-NWDGAFQWSA-N |
| XLogP | 1.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|