C16H24N2O — CID 102683220
(4aS,7aS)-6-[2-(2-methylphenoxy)ethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102683220) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (4aS,7aS)-6-[2-(2-methylphenoxy)ethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[2-(2-methylphenoxy)ethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102683220 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (4aS,7aS)-6-[2-(2-methylphenoxy)ethyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | Cc1ccccc1OCCN1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C16H24N2O/c1-13-5-2-3-7-16(13)19-10-9-18-11-14-6-4-8-17-15(14)12-18/h2-3,5,7,14-15,17H,4,6,8-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | QONROBHQVRTDGD-LSDHHAIUSA-N |
| XLogP | 2.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |