C20H43NO2 — CID 10268400
2-amino-3,7,11,15-tetramethylhexadecane-1,3-diol (PubChem CID 10268400) has the molecular formula C20H43NO2 and a molecular weight of 329.57 g/mol. Its IUPAC name is 2-amino-3,7,11,15-tetramethylhexadecane-1,3-diol.
| Compound Name | 2-amino-3,7,11,15-tetramethylhexadecane-1,3-diol |
|---|---|
| PubChem CID | 10268400 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 2-amino-3,7,11,15-tetramethylhexadecane-1,3-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)(O)C(N)CO |
| InChI | InChI=1S/C20H43NO2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5,23)19(21)15-22/h16-19,22-23H,6-15,21H2,1-5H3 |
| InChIKey | WDYIFOMXHWICLM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |