C19H22N6 — CID 10268586
12-cyclopentyl-10-ethyl-5-pyridin-4-yl-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene (PubChem CID 10268586) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 12-cyclopentyl-10-ethyl-5-pyridin-4-yl-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene.
| Compound Name | 12-cyclopentyl-10-ethyl-5-pyridin-4-yl-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene |
|---|---|
| PubChem CID | 10268586 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 12-cyclopentyl-10-ethyl-5-pyridin-4-yl-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene |
| SMILES | CCc1nn(C2CCCC2)c2c1CCn1c(-c3ccncc3)nnc1-2 |
| InChI | InChI=1S/C19H22N6/c1-2-16-15-9-12-24-18(13-7-10-20-11-8-13)21-22-19(24)17(15)25(23-16)14-5-3-4-6-14/h7-8,10-11,14H,2-6,9,12H2,1H3 |
| InChIKey | ZMFFNWKGXSCXBM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |