About 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol
7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol (PubChem CID 10268594) has the molecular formula C18H38O3S
and a molecular weight of 334.57 g/mol. Its IUPAC name is 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol.
Molecular Properties
| Compound Name | 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol |
| PubChem CID | 10268594 |
| Molecular Formula | C18H38O3S |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol |
| SMILES | CC(C)(CO)CCCCCS(=O)CCCCCC(C)(C)CO |
| InChI | InChI=1S/C18H38O3S/c1-17(2,15-19)11-7-5-9-13-22(21)14-10-6-8-12-18(3,4)16-20/h19-20H,5-16H2,1-4H3 |
| InChIKey | HXDJPGLTHJNXLY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol?
The IUPAC name of 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol (CID 10268594) is 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol.
What is the SMILES notation for 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol?
The canonical SMILES for 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol is CC(C)(CO)CCCCCS(=O)CCCCCC(C)(C)CO.
What is the InChIKey of 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol?
The InChIKey is HXDJPGLTHJNXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O3S/c1-17(2,15-19)11-7-5-9-13-22(21)14-10-6-8-12-18(3,4)16-20/h19-20H,5-16H2,1-4H3.
What are the key properties of 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol?
7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol has a molecular weight of 334.57 g/mol, XLogP of 3.89, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(7-hydroxy-6,6-dimethylheptyl)sulfinyl-2,2-dimethylheptan-1-ol is sourced from PubChem (CID 10268594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).