C10H10N2O2S2 — CID 102686145
3-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylpropanoic acid (PubChem CID 102686145) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylpropanoic acid.
| Compound Name | 3-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 102686145 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylpropanoic acid |
| SMILES | Cc1csc2c(SCCC(=O)O)ncnc12 |
| InChI | InChI=1S/C10H10N2O2S2/c1-6-4-16-9-8(6)11-5-12-10(9)15-3-2-7(13)14/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | JHGAXCBQKNFNRV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |