C11H12N2O2S2 — CID 102686173
2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbutanoic acid (PubChem CID 102686173) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbutanoic acid.
| Compound Name | 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 102686173 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylbutanoic acid |
| SMILES | CCC(Sc1ncnc2c(C)csc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2S2/c1-3-7(11(14)15)17-10-9-8(12-5-13-10)6(2)4-16-9/h4-5,7H,3H2,1-2H3,(H,14,15) |
| InChIKey | JVYMNEMQWHBRQC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |