About 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol
2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol (PubChem CID 102686545) has the molecular formula C10H13N3O2S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol |
| PubChem CID | 102686545 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol |
| SMILES | Cc1csc2c(NC(CO)CO)ncnc12 |
| InChI | InChI=1S/C10H13N3O2S/c1-6-4-16-9-8(6)11-5-12-10(9)13-7(2-14)3-15/h4-5,7,14-15H,2-3H2,1H3,(H,11,12,13) |
| InChIKey | OHPAXBDKZBYJPD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol?
The IUPAC name of 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol (CID 102686545) is 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol.
What is the SMILES notation for 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol?
The canonical SMILES for 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol is Cc1csc2c(NC(CO)CO)ncnc12.
What is the InChIKey of 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol?
The InChIKey is OHPAXBDKZBYJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S/c1-6-4-16-9-8(6)11-5-12-10(9)13-7(2-14)3-15/h4-5,7,14-15H,2-3H2,1H3,(H,11,12,13).
What are the key properties of 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol?
2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol has a molecular weight of 239.30 g/mol, XLogP of 0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]propane-1,3-diol is sourced from PubChem (CID 102686545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).