C11H17NO6 — CID 102688062
5-[(4-methoxy-4-oxobutyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 102688062) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is 5-[(4-methoxy-4-oxobutyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(4-methoxy-4-oxobutyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102688062 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 5-[(4-methoxy-4-oxobutyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | COC(=O)CCCNC(=O)C1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C11H17NO6/c1-17-9(13)3-2-6-12-10(14)7-4-5-8(18-7)11(15)16/h7-8H,2-6H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | YKKWUZUNQXDANO-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|