About 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid
5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid (PubChem CID 102688545) has the molecular formula C10H14F3NO5
and a molecular weight of 285.22 g/mol. Its IUPAC name is 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid |
| PubChem CID | 102688545 |
| Molecular Formula | C10H14F3NO5 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCOCC(F)(F)F)O1 |
| InChI | InChI=1S/C10H14F3NO5/c11-10(12,13)5-18-4-3-14-8(15)6-1-2-7(19-6)9(16)17/h6-7H,1-5H2,(H,14,15)(H,16,17) |
| InChIKey | BHLUEHPQNSFDGW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid (CID 102688545) is 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid is O=C(O)C1CCC(C(=O)NCCOCC(F)(F)F)O1.
What is the InChIKey of 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid?
The InChIKey is BHLUEHPQNSFDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO5/c11-10(12,13)5-18-4-3-14-8(15)6-1-2-7(19-6)9(16)17/h6-7H,1-5H2,(H,14,15)(H,16,17).
What are the key properties of 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid?
5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid has a molecular weight of 285.22 g/mol, XLogP of 0.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 102688545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).