C12H12FNO5 — CID 102688607
5-[(3-fluoro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 102688607) has the molecular formula C12H12FNO5 and a molecular weight of 269.23 g/mol. Its IUPAC name is 5-[(3-fluoro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(3-fluoro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102688607 |
| Molecular Formula | C12H12FNO5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-[(3-fluoro-4-hydroxyphenyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)Nc2ccc(O)c(F)c2)O1 |
| InChI | InChI=1S/C12H12FNO5/c13-7-5-6(1-2-8(7)15)14-11(16)9-3-4-10(19-9)12(17)18/h1-2,5,9-10,15H,3-4H2,(H,14,16)(H,17,18) |
| InChIKey | BWUWGSADIOPIFF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|