C15H15FN2O3 — CID 102689586
5-(1-cyclopropyl-5-fluorobenzimidazol-2-yl)oxolane-2-carboxylic acid (PubChem CID 102689586) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-(1-cyclopropyl-5-fluorobenzimidazol-2-yl)oxolane-2-carboxylic acid.
| Compound Name | 5-(1-cyclopropyl-5-fluorobenzimidazol-2-yl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102689586 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 5-(1-cyclopropyl-5-fluorobenzimidazol-2-yl)oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2nc3cc(F)ccc3n2C2CC2)O1 |
| InChI | InChI=1S/C15H15FN2O3/c16-8-1-4-11-10(7-8)17-14(18(11)9-2-3-9)12-5-6-13(21-12)15(19)20/h1,4,7,9,12-13H,2-3,5-6H2,(H,19,20) |
| InChIKey | DKZOALGLELFSDQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |