C12H10BrNO3 — CID 102689766
3-(2-bromophenyl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 102689766) has the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. Its IUPAC name is 3-(2-bromophenyl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(2-bromophenyl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 102689766 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 3-(2-bromophenyl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C1C2CCC(O2)C(=O)N1c1ccccc1Br |
| InChI | InChI=1S/C12H10BrNO3/c13-7-3-1-2-4-8(7)14-11(15)9-5-6-10(17-9)12(14)16/h1-4,9-10H,5-6H2 |
| InChIKey | JFXHPGFIKQXMRR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|